C27H32Cl3N3O2S — CID 162344988
1-benzhydryl-4-[(1E)-3,4,4-trichloro-1-hexylsulfanyl-2-nitrobuta-1,3-dienyl]piperazine (PubChem CID 162344988) has the molecular formula C27H32Cl3N3O2S and a molecular weight of 569.00 g/mol. Its IUPAC name is 1-benzhydryl-4-[(1E)-3,4,4-trichloro-1-hexylsulfanyl-2-nitrobuta-1,3-dienyl]piperazine.
| Compound Name | 1-benzhydryl-4-[(1E)-3,4,4-trichloro-1-hexylsulfanyl-2-nitrobuta-1,3-dienyl]piperazine |
|---|---|
| PubChem CID | 162344988 |
| Molecular Formula | C27H32Cl3N3O2S |
| Molecular Weight | 569.00 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | 1-benzhydryl-4-[(1E)-3,4,4-trichloro-1-hexylsulfanyl-2-nitrobuta-1,3-dienyl]piperazine |
| SMILES | CCCCCCS/C(=C(\C(Cl)=C(Cl)Cl)[N+](=O)[O-])N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32Cl3N3O2S/c1-2-3-4-11-20-36-27(25(33(34)35)23(28)26(29)30)32-18-16-31(17-19-32)24(21-12-7-5-8-13-21)22-14-9-6-10-15-22/h5-10,12-15,24H,2-4,11,16-20H2,1H3/b27-25+ |
| InChIKey | MZTVIBUOYQIFKX-IMVLJIQESA-N |
| XLogP | 8.04 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.00 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|