C16H17Cl2N3O4S — CID 134921039
1-[(1Z,3E)-1-benzylsulfanyl-3,4-dichloro-2,4-dinitrobuta-1,3-dienyl]piperidine (PubChem CID 134921039) has the molecular formula C16H17Cl2N3O4S and a molecular weight of 418.30 g/mol. Its IUPAC name is 1-[(1Z,3E)-1-benzylsulfanyl-3,4-dichloro-2,4-dinitrobuta-1,3-dienyl]piperidine.
| Compound Name | 1-[(1Z,3E)-1-benzylsulfanyl-3,4-dichloro-2,4-dinitrobuta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 134921039 |
| Molecular Formula | C16H17Cl2N3O4S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 1-[(1Z,3E)-1-benzylsulfanyl-3,4-dichloro-2,4-dinitrobuta-1,3-dienyl]piperidine |
| SMILES | O=[N+]([O-])C(=C(\SCc1ccccc1)N1CCCCC1)/C(Cl)=C(\Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C16H17Cl2N3O4S/c17-13(15(18)21(24)25)14(20(22)23)16(19-9-5-2-6-10-19)26-11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2/b15-13-,16-14- |
| InChIKey | CODVLQCYZROQQJ-VMNXYWKNSA-N |
| XLogP | 4.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|