C19H26N2S — CID 45189224
N-methyl-N-(2-phenylethyl)-1-(thiophen-2-ylmethyl)piperidin-3-amine (PubChem CID 45189224) has the molecular formula C19H26N2S and a molecular weight of 314.50 g/mol. Its IUPAC name is N-methyl-N-(2-phenylethyl)-1-(thiophen-2-ylmethyl)piperidin-3-amine.
| Compound Name | N-methyl-N-(2-phenylethyl)-1-(thiophen-2-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 45189224 |
| Molecular Formula | C19H26N2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-methyl-N-(2-phenylethyl)-1-(thiophen-2-ylmethyl)piperidin-3-amine |
| SMILES | CN(CCc1ccccc1)C1CCCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C19H26N2S/c1-20(13-11-17-7-3-2-4-8-17)18-9-5-12-21(15-18)16-19-10-6-14-22-19/h2-4,6-8,10,14,18H,5,9,11-13,15-16H2,1H3 |
| InChIKey | IUDYAGVDTBBDIU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |