C21H28N2OS — CID 45240726
N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 45240726) has the molecular formula C21H28N2OS and a molecular weight of 356.53 g/mol. Its IUPAC name is N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 45240726 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-methyl-N-[1-(3-phenylpropyl)piperidin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | CN(C(=O)Cc1cccs1)C1CCCN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H28N2OS/c1-22(21(24)16-20-12-7-15-25-20)19-11-6-14-23(17-19)13-5-10-18-8-3-2-4-9-18/h2-4,7-9,12,15,19H,5-6,10-11,13-14,16-17H2,1H3 |
| InChIKey | PNZAFTGXLDKOCG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |