C23H30N2OS — CID 25364028
N-methyl-2-methylsulfanyl-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]benzamide (PubChem CID 25364028) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is N-methyl-2-methylsulfanyl-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]benzamide.
| Compound Name | N-methyl-2-methylsulfanyl-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 25364028 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-methyl-2-methylsulfanyl-N-[(3S)-1-(3-phenylpropyl)piperidin-3-yl]benzamide |
| SMILES | CSc1ccccc1C(=O)N(C)[C@H]1CCCN(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C23H30N2OS/c1-24(23(26)21-14-6-7-15-22(21)27-2)20-13-9-17-25(18-20)16-8-12-19-10-4-3-5-11-19/h3-7,10-11,14-15,20H,8-9,12-13,16-18H2,1-2H3/t20-/m0/s1 |
| InChIKey | LDNYKKMZIQRADR-FQEVSTJZSA-N |
| XLogP | 4.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |