C24H32N2OS — CID 51633830
2-methyl-4-[5-[[(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]methyl]thiophen-2-yl]but-3-yn-2-ol (PubChem CID 51633830) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is 2-methyl-4-[5-[[(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]methyl]thiophen-2-yl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[5-[[(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]methyl]thiophen-2-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 51633830 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-methyl-4-[5-[[(3R)-3-[methyl(2-phenylethyl)amino]piperidin-1-yl]methyl]thiophen-2-yl]but-3-yn-2-ol |
| SMILES | CN(CCc1ccccc1)[C@@H]1CCCN(Cc2ccc(C#CC(C)(C)O)s2)C1 |
| InChI | InChI=1S/C24H32N2OS/c1-24(2,27)15-13-22-11-12-23(28-22)19-26-16-7-10-21(18-26)25(3)17-14-20-8-5-4-6-9-20/h4-6,8-9,11-12,21,27H,7,10,14,16-19H2,1-3H3/t21-/m1/s1 |
| InChIKey | WSVZUBIIIRRQKF-OAQYLSRUSA-N |
| XLogP | 4.01 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|