C23H27NO3S — CID 45188684
[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone (PubChem CID 45188684) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is [1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 45188684 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)C2CCCN(Cc3ccc(C#CC(C)(C)O)s3)C2)c1 |
| InChI | InChI=1S/C23H27NO3S/c1-23(2,26)12-11-20-9-10-21(28-20)16-24-13-5-7-18(15-24)22(25)17-6-4-8-19(14-17)27-3/h4,6,8-10,14,18,26H,5,7,13,15-16H2,1-3H3 |
| InChIKey | RVZVJOBVWVHGMI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|