C22H24ClNO2S — CID 45193687
(4-chlorophenyl)-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methanone (PubChem CID 45193687) has the molecular formula C22H24ClNO2S and a molecular weight of 401.96 g/mol. Its IUPAC name is (4-chlorophenyl)-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45193687 |
| Molecular Formula | C22H24ClNO2S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (4-chlorophenyl)-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methanone |
| SMILES | CC(C)(O)C#Cc1ccc(CN2CCCC(C(=O)c3ccc(Cl)cc3)C2)s1 |
| InChI | InChI=1S/C22H24ClNO2S/c1-22(2,26)12-11-19-9-10-20(27-19)15-24-13-3-4-17(14-24)21(25)16-5-7-18(23)8-6-16/h5-10,17,26H,3-4,13-15H2,1-2H3 |
| InChIKey | YAKATQYAFORXBG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|