C16H22ClNOS — CID 42209681
(4-chlorophenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone (PubChem CID 42209681) has the molecular formula C16H22ClNOS and a molecular weight of 311.88 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42209681 |
| Molecular Formula | C16H22ClNOS |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (4-chlorophenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone |
| SMILES | CSCCCN1CCC[C@@H](C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H22ClNOS/c1-20-11-3-10-18-9-2-4-14(12-18)16(19)13-5-7-15(17)8-6-13/h5-8,14H,2-4,9-12H2,1H3/t14-/m1/s1 |
| InChIKey | WEFFDNPZKFHSGQ-CQSZACIVSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|