C17H24ClNO2S — CID 26407940
(5-chloro-2-methoxyphenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone (PubChem CID 26407940) has the molecular formula C17H24ClNO2S and a molecular weight of 341.90 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 26407940 |
| Molecular Formula | C17H24ClNO2S |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-[(3R)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)[C@@H]1CCCN(CCCSC)C1 |
| InChI | InChI=1S/C17H24ClNO2S/c1-21-16-7-6-14(18)11-15(16)17(20)13-5-3-8-19(12-13)9-4-10-22-2/h6-7,11,13H,3-5,8-10,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | PTWNGAATKDXXDR-CYBMUJFWSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|