C20H29ClN2OS — CID 42401799
1-(4-chlorophenyl)-N-[[(3S)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methyl]cyclopropane-1-carboxamide (PubChem CID 42401799) has the molecular formula C20H29ClN2OS and a molecular weight of 380.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[[(3S)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[[(3S)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42401799 |
| Molecular Formula | C20H29ClN2OS |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[[(3S)-1-(3-methylsulfanylpropyl)piperidin-3-yl]methyl]cyclopropane-1-carboxamide |
| SMILES | CSCCCN1CCC[C@@H](CNC(=O)C2(c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C20H29ClN2OS/c1-25-13-3-12-23-11-2-4-16(15-23)14-22-19(24)20(9-10-20)17-5-7-18(21)8-6-17/h5-8,16H,2-4,9-15H2,1H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | QOUOAKQGLXZCLK-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|