C21H24ClN3O — CID 72884299
1-(4-chlorophenyl)-N-[(1-pyridin-4-ylpiperidin-3-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 72884299) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(1-pyridin-4-ylpiperidin-3-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(1-pyridin-4-ylpiperidin-3-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 72884299 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(1-pyridin-4-ylpiperidin-3-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCC1CCCN(c2ccncc2)C1)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O/c22-18-5-3-17(4-6-18)21(9-10-21)20(26)24-14-16-2-1-13-25(15-16)19-7-11-23-12-8-19/h3-8,11-12,16H,1-2,9-10,13-15H2,(H,24,26) |
| InChIKey | OGGZVQLLHIDYDG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |