C20H26N4O2S — CID 42244504
N-[2-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-4-yl]pyrazol-3-yl]acetamide (PubChem CID 42244504) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[2-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-4-yl]pyrazol-3-yl]acetamide.
| Compound Name | N-[2-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-4-yl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 42244504 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[2-[1-[[5-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]methyl]piperidin-4-yl]pyrazol-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccnn1C1CCN(Cc2ccc(C#CC(C)(C)O)s2)CC1 |
| InChI | InChI=1S/C20H26N4O2S/c1-15(25)22-19-7-11-21-24(19)16-8-12-23(13-9-16)14-18-5-4-17(27-18)6-10-20(2,3)26/h4-5,7,11,16,26H,8-9,12-14H2,1-3H3,(H,22,25) |
| InChIKey | GCMUGCLBNXTARS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|