C25H27N5OS — CID 26329645
1-[2-[1-(1-benzothiophen-2-ylmethyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea (PubChem CID 26329645) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is 1-[2-[1-(1-benzothiophen-2-ylmethyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[2-[1-(1-benzothiophen-2-ylmethyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 26329645 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-[2-[1-(1-benzothiophen-2-ylmethyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ccnn1C1CCN(Cc2cc3ccccc3s2)CC1 |
| InChI | InChI=1S/C25H27N5OS/c1-18-6-2-4-8-22(18)27-25(31)28-24-10-13-26-30(24)20-11-14-29(15-12-20)17-21-16-19-7-3-5-9-23(19)32-21/h2-10,13,16,20H,11-12,14-15,17H2,1H3,(H2,27,28,31) |
| InChIKey | YDRXMPBCFNNSDH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |