C26H33N5O2 — CID 45242231
1-(2-methoxyphenyl)-3-[2-[1-(3-phenylbutyl)piperidin-4-yl]pyrazol-3-yl]urea (PubChem CID 45242231) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[2-[1-(3-phenylbutyl)piperidin-4-yl]pyrazol-3-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[2-[1-(3-phenylbutyl)piperidin-4-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 45242231 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[2-[1-(3-phenylbutyl)piperidin-4-yl]pyrazol-3-yl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccnn1C1CCN(CCC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33N5O2/c1-20(21-8-4-3-5-9-21)13-17-30-18-14-22(15-19-30)31-25(12-16-27-31)29-26(32)28-23-10-6-7-11-24(23)33-2/h3-12,16,20,22H,13-15,17-19H2,1-2H3,(H2,28,29,32) |
| InChIKey | GWJCPJWOGOXZNL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |