C22H24N6O3 — CID 24819333
1-(2-methoxyphenyl)-3-[2-[1-(pyridine-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea (PubChem CID 24819333) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[2-[1-(pyridine-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[2-[1-(pyridine-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 24819333 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[2-[1-(pyridine-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccnn1C1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C22H24N6O3/c1-31-19-7-3-2-6-18(19)25-22(30)26-20-8-12-24-28(20)17-9-13-27(14-10-17)21(29)16-5-4-11-23-15-16/h2-8,11-12,15,17H,9-10,13-14H2,1H3,(H2,25,26,30) |
| InChIKey | AOSLQFNORIVQEG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |