C24H27N5O4 — CID 26391328
1-[2-[1-(3-methoxybenzoyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methoxyphenyl)urea (PubChem CID 26391328) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[2-[1-(3-methoxybenzoyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[2-[1-(3-methoxybenzoyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 26391328 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-[2-[1-(3-methoxybenzoyl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1cccc(C(=O)N2CCC(n3nccc3NC(=O)Nc3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C24H27N5O4/c1-32-19-7-5-6-17(16-19)23(30)28-14-11-18(12-15-28)29-22(10-13-25-29)27-24(31)26-20-8-3-4-9-21(20)33-2/h3-10,13,16,18H,11-12,14-15H2,1-2H3,(H2,26,27,31) |
| InChIKey | IXRLBROSMBQPKF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |