C23H32N6O3 — CID 26336813
1-(2-methoxyphenyl)-3-[2-[1-(2-piperidin-1-ylacetyl)piperidin-4-yl]pyrazol-3-yl]urea (PubChem CID 26336813) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[2-[1-(2-piperidin-1-ylacetyl)piperidin-4-yl]pyrazol-3-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[2-[1-(2-piperidin-1-ylacetyl)piperidin-4-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 26336813 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[2-[1-(2-piperidin-1-ylacetyl)piperidin-4-yl]pyrazol-3-yl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccnn1C1CCN(C(=O)CN2CCCCC2)CC1 |
| InChI | InChI=1S/C23H32N6O3/c1-32-20-8-4-3-7-19(20)25-23(31)26-21-9-12-24-29(21)18-10-15-28(16-11-18)22(30)17-27-13-5-2-6-14-27/h3-4,7-9,12,18H,2,5-6,10-11,13-17H2,1H3,(H2,25,26,31) |
| InChIKey | WWYGOZMIKJPFNH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |