C25H31N5O3 — CID 26336058
1-(2-methoxyphenyl)-3-[2-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]pyrazol-3-yl]urea (PubChem CID 26336058) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[2-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]pyrazol-3-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[2-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 26336058 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[2-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]pyrazol-3-yl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccnn1C1CCN([C@@H](C)COc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31N5O3/c1-19(18-33-21-8-4-3-5-9-21)29-16-13-20(14-17-29)30-24(12-15-26-30)28-25(31)27-22-10-6-7-11-23(22)32-2/h3-12,15,19-20H,13-14,16-18H2,1-2H3,(H2,27,28,31)/t19-/m0/s1 |
| InChIKey | VLXQEEVKZVAETN-IBGZPJMESA-N |
| XLogP | 4.64 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |