C19H26N6O3 — CID 42513641
N-ethyl-4-[5-[(2-methoxyphenyl)carbamoylamino]pyrazol-1-yl]piperidine-1-carboxamide (PubChem CID 42513641) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-ethyl-4-[5-[(2-methoxyphenyl)carbamoylamino]pyrazol-1-yl]piperidine-1-carboxamide.
| Compound Name | N-ethyl-4-[5-[(2-methoxyphenyl)carbamoylamino]pyrazol-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42513641 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-ethyl-4-[5-[(2-methoxyphenyl)carbamoylamino]pyrazol-1-yl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(n2nccc2NC(=O)Nc2ccccc2OC)CC1 |
| InChI | InChI=1S/C19H26N6O3/c1-3-20-19(27)24-12-9-14(10-13-24)25-17(8-11-21-25)23-18(26)22-15-6-4-5-7-16(15)28-2/h4-8,11,14H,3,9-10,12-13H2,1-2H3,(H,20,27)(H2,22,23,26) |
| InChIKey | DRRDSWOXKKOFOE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |