C20H22ClN7O2 — CID 25371671
1-(2-chlorophenyl)-3-[2-[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea (PubChem CID 25371671) has the molecular formula C20H22ClN7O2 and a molecular weight of 427.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 25371671 |
| Molecular Formula | C20H22ClN7O2 |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-[1-(2-methylpyrazole-3-carbonyl)piperidin-4-yl]pyrazol-3-yl]urea |
| SMILES | Cn1nccc1C(=O)N1CCC(n2nccc2NC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H22ClN7O2/c1-26-17(6-10-22-26)19(29)27-12-8-14(9-13-27)28-18(7-11-23-28)25-20(30)24-16-5-3-2-4-15(16)21/h2-7,10-11,14H,8-9,12-13H2,1H3,(H2,24,25,30) |
| InChIKey | WQZCCGQQMXMNLK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |