C23H32ClN5O — CID 26320023
1-(2-chlorophenyl)-3-[2-[1-(3-cyclopentylpropyl)piperidin-4-yl]pyrazol-3-yl]urea (PubChem CID 26320023) has the molecular formula C23H32ClN5O and a molecular weight of 430.00 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[2-[1-(3-cyclopentylpropyl)piperidin-4-yl]pyrazol-3-yl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[2-[1-(3-cyclopentylpropyl)piperidin-4-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 26320023 |
| Molecular Formula | C23H32ClN5O |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[2-[1-(3-cyclopentylpropyl)piperidin-4-yl]pyrazol-3-yl]urea |
| SMILES | O=C(Nc1ccccc1Cl)Nc1ccnn1C1CCN(CCCC2CCCC2)CC1 |
| InChI | InChI=1S/C23H32ClN5O/c24-20-9-3-4-10-21(20)26-23(30)27-22-11-14-25-29(22)19-12-16-28(17-13-19)15-5-8-18-6-1-2-7-18/h3-4,9-11,14,18-19H,1-2,5-8,12-13,15-17H2,(H2,26,27,30) |
| InChIKey | LOHOOAVDZJTPRC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |