C22H29ClN6O2 — CID 26327836
4-[5-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-cyclohexylpiperidine-1-carboxamide (PubChem CID 26327836) has the molecular formula C22H29ClN6O2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 4-[5-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-cyclohexylpiperidine-1-carboxamide.
| Compound Name | 4-[5-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-cyclohexylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 26327836 |
| Molecular Formula | C22H29ClN6O2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[5-[(2-chlorophenyl)carbamoylamino]pyrazol-1-yl]-N-cyclohexylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)Nc1ccnn1C1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H29ClN6O2/c23-18-8-4-5-9-19(18)26-21(30)27-20-10-13-24-29(20)17-11-14-28(15-12-17)22(31)25-16-6-2-1-3-7-16/h4-5,8-10,13,16-17H,1-3,6-7,11-12,14-15H2,(H,25,31)(H2,26,27,30) |
| InChIKey | HXHSMVBEBRPVFA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |