C20H24N8O — CID 56754329
1-[2-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea (PubChem CID 56754329) has the molecular formula C20H24N8O and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-[2-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[2-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 56754329 |
| Molecular Formula | C20H24N8O |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-[2-[1-(2-aminopyrimidin-4-yl)piperidin-4-yl]pyrazol-3-yl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)Nc1ccnn1C1CCN(c2ccnc(N)n2)CC1 |
| InChI | InChI=1S/C20H24N8O/c1-14-4-2-3-5-16(14)24-20(29)26-18-7-11-23-28(18)15-8-12-27(13-9-15)17-6-10-22-19(21)25-17/h2-7,10-11,15H,8-9,12-13H2,1H3,(H2,21,22,25)(H2,24,26,29) |
| InChIKey | RMGRJSBOGXWDRB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |