C21H32N2O2S — CID 28810331
4-[5-[[(3S)-3-(2-hydroxyethyl)-4-(3-methylbut-2-enyl)piperazin-1-yl]methyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol (PubChem CID 28810331) has the molecular formula C21H32N2O2S and a molecular weight of 376.57 g/mol. Its IUPAC name is 4-[5-[[(3S)-3-(2-hydroxyethyl)-4-(3-methylbut-2-enyl)piperazin-1-yl]methyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[5-[[(3S)-3-(2-hydroxyethyl)-4-(3-methylbut-2-enyl)piperazin-1-yl]methyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 28810331 |
| Molecular Formula | C21H32N2O2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[5-[[(3S)-3-(2-hydroxyethyl)-4-(3-methylbut-2-enyl)piperazin-1-yl]methyl]thiophen-2-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)=CCN1CCN(Cc2ccc(C#CC(C)(C)O)s2)C[C@@H]1CCO |
| InChI | InChI=1S/C21H32N2O2S/c1-17(2)8-11-23-13-12-22(15-18(23)9-14-24)16-20-6-5-19(26-20)7-10-21(3,4)25/h5-6,8,18,24-25H,9,11-16H2,1-4H3/t18-/m0/s1 |
| InChIKey | YRFKHNNDIGRURH-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|