C18H19IN2O4S2 — CID 162416718
(3S,4Z)-4-[iodo(thiophen-2-yl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine (PubChem CID 162416718) has the molecular formula C18H19IN2O4S2 and a molecular weight of 518.40 g/mol. Its IUPAC name is (3S,4Z)-4-[iodo(thiophen-2-yl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine.
| Compound Name | (3S,4Z)-4-[iodo(thiophen-2-yl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
|---|---|
| PubChem CID | 162416718 |
| Molecular Formula | C18H19IN2O4S2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | (3S,4Z)-4-[iodo(thiophen-2-yl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\I)c3cccs3)[C@@](C)(C[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C18H19IN2O4S2/c1-13-5-7-14(8-6-13)27(24,25)20-10-15(17(19)16-4-3-9-26-16)18(2,11-20)12-21(22)23/h3-9H,10-12H2,1-2H3/b17-15+/t18-/m1/s1 |
| InChIKey | XCXCVMYAUUSRQL-WBWKYDSYSA-N |
| XLogP | 4.19 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|