C14H17IN2O4S — CID 162416734
(3S,4Z)-4-(iodomethylidene)-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine (PubChem CID 162416734) has the molecular formula C14H17IN2O4S and a molecular weight of 436.27 g/mol. Its IUPAC name is (3S,4Z)-4-(iodomethylidene)-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine.
| Compound Name | (3S,4Z)-4-(iodomethylidene)-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
|---|---|
| PubChem CID | 162416734 |
| Molecular Formula | C14H17IN2O4S |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | (3S,4Z)-4-(iodomethylidene)-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C\I)[C@@](C)(C[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C14H17IN2O4S/c1-11-3-5-13(6-4-11)22(20,21)16-8-12(7-15)14(2,9-16)10-17(18)19/h3-7H,8-10H2,1-2H3/b12-7+/t14-/m1/s1 |
| InChIKey | PULFHWIUNFVPTA-WEKMIXOTSA-N |
| XLogP | 2.60 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|