C21H20F3IN2O4S — CID 162416722
(3S,4Z)-4-[iodo-[4-(trifluoromethyl)phenyl]methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine (PubChem CID 162416722) has the molecular formula C21H20F3IN2O4S and a molecular weight of 580.37 g/mol. Its IUPAC name is (3S,4Z)-4-[iodo-[4-(trifluoromethyl)phenyl]methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine.
| Compound Name | (3S,4Z)-4-[iodo-[4-(trifluoromethyl)phenyl]methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
|---|---|
| PubChem CID | 162416722 |
| Molecular Formula | C21H20F3IN2O4S |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 580.01 |
| IUPAC Name | (3S,4Z)-4-[iodo-[4-(trifluoromethyl)phenyl]methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\I)c3ccc(C(F)(F)F)cc3)[C@@](C)(C[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C21H20F3IN2O4S/c1-14-3-9-17(10-4-14)32(30,31)26-11-18(20(2,12-26)13-27(28)29)19(25)15-5-7-16(8-6-15)21(22,23)24/h3-10H,11-13H2,1-2H3/b19-18+/t20-/m1/s1 |
| InChIKey | WPNLZHLLCUGXDU-LNEUUDGLSA-N |
| XLogP | 5.15 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|