C21H20IN3O4S — CID 162416719
4-[(Z)-iodo-[(4S)-4-methyl-1-(4-methylphenyl)sulfonyl-4-(nitromethyl)pyrrolidin-3-ylidene]methyl]benzonitrile (PubChem CID 162416719) has the molecular formula C21H20IN3O4S and a molecular weight of 537.38 g/mol. Its IUPAC name is 4-[(Z)-iodo-[(4S)-4-methyl-1-(4-methylphenyl)sulfonyl-4-(nitromethyl)pyrrolidin-3-ylidene]methyl]benzonitrile.
| Compound Name | 4-[(Z)-iodo-[(4S)-4-methyl-1-(4-methylphenyl)sulfonyl-4-(nitromethyl)pyrrolidin-3-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 162416719 |
| Molecular Formula | C21H20IN3O4S |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | 4-[(Z)-iodo-[(4S)-4-methyl-1-(4-methylphenyl)sulfonyl-4-(nitromethyl)pyrrolidin-3-ylidene]methyl]benzonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\I)c3ccc(C#N)cc3)[C@@](C)(C[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C21H20IN3O4S/c1-15-3-9-18(10-4-15)30(28,29)24-12-19(21(2,13-24)14-25(26)27)20(22)17-7-5-16(11-23)6-8-17/h3-10H,12-14H2,1-2H3/b20-19+/t21-/m1/s1 |
| InChIKey | JSCZIPYFRSCCQF-RABMLOOZSA-N |
| XLogP | 4.00 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|