C21H23IN2O4S — CID 162416726
(3S,4Z)-4-[iodo-(3-methylphenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine (PubChem CID 162416726) has the molecular formula C21H23IN2O4S and a molecular weight of 526.40 g/mol. Its IUPAC name is (3S,4Z)-4-[iodo-(3-methylphenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine.
| Compound Name | (3S,4Z)-4-[iodo-(3-methylphenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
|---|---|
| PubChem CID | 162416726 |
| Molecular Formula | C21H23IN2O4S |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | (3S,4Z)-4-[iodo-(3-methylphenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\I)c3cccc(C)c3)[C@@](C)(C[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C21H23IN2O4S/c1-15-7-9-18(10-8-15)29(27,28)23-12-19(21(3,13-23)14-24(25)26)20(22)17-6-4-5-16(2)11-17/h4-11H,12-14H2,1-3H3/b20-19+/t21-/m1/s1 |
| InChIKey | JWKYKNOKUANMQX-RABMLOOZSA-N |
| XLogP | 4.44 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|