C19H20N2O4S — CID 71527040
(2S,3R,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenylpyrrolidine (PubChem CID 71527040) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2S,3R,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenylpyrrolidine.
| Compound Name | (2S,3R,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 71527040 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2S,3R,5S)-5-ethenyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenylpyrrolidine |
| SMILES | C=C[C@@H]1C[C@@H]([N+](=O)[O-])[C@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-3-16-13-18(21(22)23)19(15-7-5-4-6-8-15)20(16)26(24,25)17-11-9-14(2)10-12-17/h3-12,16,18-19H,1,13H2,2H3/t16-,18-,19+/m1/s1 |
| InChIKey | PFJNQYFIPDPNTB-QRQLOZEOSA-N |
| XLogP | 3.33 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|