C20H19IN2O5S — CID 162416730
(3S,4Z)-4-[iodo(phenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidin-2-one (PubChem CID 162416730) has the molecular formula C20H19IN2O5S and a molecular weight of 526.35 g/mol. Its IUPAC name is (3S,4Z)-4-[iodo(phenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidin-2-one.
| Compound Name | (3S,4Z)-4-[iodo(phenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 162416730 |
| Molecular Formula | C20H19IN2O5S |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | (3S,4Z)-4-[iodo(phenyl)methylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\I)c3ccccc3)[C@@](C)(C[N+](=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C20H19IN2O5S/c1-14-8-10-16(11-9-14)29(27,28)22-12-17(18(21)15-6-4-3-5-7-15)20(2,19(22)24)13-23(25)26/h3-11H,12-13H2,1-2H3/b18-17+/t20-/m1/s1 |
| InChIKey | NOBXODPLKQOWEJ-CECJQHFESA-N |
| XLogP | 3.66 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|