C32H34INO2S — CID 71513714
(4Z)-4-[iodo-(4-phenylphenyl)methylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene (PubChem CID 71513714) has the molecular formula C32H34INO2S and a molecular weight of 623.60 g/mol. Its IUPAC name is (4Z)-4-[iodo-(4-phenylphenyl)methylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene.
| Compound Name | (4Z)-4-[iodo-(4-phenylphenyl)methylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene |
|---|---|
| PubChem CID | 71513714 |
| Molecular Formula | C32H34INO2S |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | (4Z)-4-[iodo-(4-phenylphenyl)methylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\I)c3ccc(-c4ccccc4)cc3)C3(CC=CCC(C)(C)C3)C2)cc1 |
| InChI | InChI=1S/C32H34INO2S/c1-24-11-17-28(18-12-24)37(35,36)34-21-29(32(23-34)20-8-7-19-31(2,3)22-32)30(33)27-15-13-26(14-16-27)25-9-5-4-6-10-25/h4-18H,19-23H2,1-3H3/b30-29+ |
| InChIKey | IZWAAGBBDDEFTR-QVIHXGFCSA-N |
| XLogP | 8.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|