C26H29BrClNO2S — CID 71512610
(4Z)-4-[(4-bromophenyl)-chloromethylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene (PubChem CID 71512610) has the molecular formula C26H29BrClNO2S and a molecular weight of 534.95 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)-chloromethylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene.
| Compound Name | (4Z)-4-[(4-bromophenyl)-chloromethylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene |
|---|---|
| PubChem CID | 71512610 |
| Molecular Formula | C26H29BrClNO2S |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)-chloromethylidene]-7,7-dimethyl-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.6]undec-9-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\Cl)c3ccc(Br)cc3)C3(CC=CCC(C)(C)C3)C2)cc1 |
| InChI | InChI=1S/C26H29BrClNO2S/c1-19-6-12-22(13-7-19)32(30,31)29-16-23(24(28)20-8-10-21(27)11-9-20)26(18-29)15-5-4-14-25(2,3)17-26/h4-13H,14-18H2,1-3H3/b24-23+ |
| InChIKey | CNUITJQVOSVMJQ-WCWDXBQESA-N |
| XLogP | 7.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|