C23H24FNO2S — CID 139092720
(4Z,5R)-4-[fluoro(phenyl)methylidene]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]dec-6-ene (PubChem CID 139092720) has the molecular formula C23H24FNO2S and a molecular weight of 397.52 g/mol. Its IUPAC name is (4Z,5R)-4-[fluoro(phenyl)methylidene]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]dec-6-ene.
| Compound Name | (4Z,5R)-4-[fluoro(phenyl)methylidene]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 139092720 |
| Molecular Formula | C23H24FNO2S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (4Z,5R)-4-[fluoro(phenyl)methylidene]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]dec-6-ene |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C(\F)c3ccccc3)[C@@]3(C=CCCC3)C2)cc1 |
| InChI | InChI=1S/C23H24FNO2S/c1-18-10-12-20(13-11-18)28(26,27)25-16-21(22(24)19-8-4-2-5-9-19)23(17-25)14-6-3-7-15-23/h2,4-6,8-14H,3,7,15-17H2,1H3/b22-21+/t23-/m1/s1 |
| InChIKey | YXILKBZVNBZSST-UDITXYAMSA-N |
| XLogP | 5.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|