C29H28N2O4S — CID 162416864
(3S,4Z)-3-methyl-4-[3-(4-methylphenyl)-1-phenylprop-2-ynylidene]-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine (PubChem CID 162416864) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is (3S,4Z)-3-methyl-4-[3-(4-methylphenyl)-1-phenylprop-2-ynylidene]-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine.
| Compound Name | (3S,4Z)-3-methyl-4-[3-(4-methylphenyl)-1-phenylprop-2-ynylidene]-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
|---|---|
| PubChem CID | 162416864 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | (3S,4Z)-3-methyl-4-[3-(4-methylphenyl)-1-phenylprop-2-ynylidene]-1-(4-methylphenyl)sulfonyl-3-(nitromethyl)pyrrolidine |
| SMILES | Cc1ccc(C#C/C(=C2\CN(S(=O)(=O)c3ccc(C)cc3)C[C@]2(C)C[N+](=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28N2O4S/c1-22-9-13-24(14-10-22)15-18-27(25-7-5-4-6-8-25)28-19-30(20-29(28,3)21-31(32)33)36(34,35)26-16-11-23(2)12-17-26/h4-14,16-17H,19-21H2,1-3H3/b28-27-/t29-/m1/s1 |
| InChIKey | TXWIUEBDNLCHKY-GQRBHMBBSA-N |
| XLogP | 5.10 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|