C23H23BrFNO2S — CID 139092712
(4Z,4aR)-4-[(4-bromophenyl)-fluoromethylidene]-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline (PubChem CID 139092712) has the molecular formula C23H23BrFNO2S and a molecular weight of 476.41 g/mol. Its IUPAC name is (4Z,4aR)-4-[(4-bromophenyl)-fluoromethylidene]-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline.
| Compound Name | (4Z,4aR)-4-[(4-bromophenyl)-fluoromethylidene]-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline |
|---|---|
| PubChem CID | 139092712 |
| Molecular Formula | C23H23BrFNO2S |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | (4Z,4aR)-4-[(4-bromophenyl)-fluoromethylidene]-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=CCCC[C@H]3/C(=C(/F)c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C23H23BrFNO2S/c1-16-6-12-20(13-7-16)29(27,28)26-14-18-4-2-3-5-21(18)22(15-26)23(25)17-8-10-19(24)11-9-17/h4,6-13,21H,2-3,5,14-15H2,1H3/b23-22+/t21-/m1/s1 |
| InChIKey | PPGSQVKJVJSWBW-FBNDGMMSSA-N |
| XLogP | 5.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|