C25H28N2O3S — CID 139092719
N-[(Z)-[(4aR)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinolin-4-ylidene]-phenylmethyl]acetamide (PubChem CID 139092719) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[(Z)-[(4aR)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinolin-4-ylidene]-phenylmethyl]acetamide.
| Compound Name | N-[(Z)-[(4aR)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinolin-4-ylidene]-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 139092719 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[(Z)-[(4aR)-2-(4-methylphenyl)sulfonyl-1,3,4a,5,6,7-hexahydroisoquinolin-4-ylidene]-phenylmethyl]acetamide |
| SMILES | CC(=O)N/C(=C1\CN(S(=O)(=O)c2ccc(C)cc2)CC2=CCCC[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-18-12-14-22(15-13-18)31(29,30)27-16-21-10-6-7-11-23(21)24(17-27)25(26-19(2)28)20-8-4-3-5-9-20/h3-5,8-10,12-15,23H,6-7,11,16-17H2,1-2H3,(H,26,28)/b25-24+/t23-/m1/s1 |
| InChIKey | CYFGQKPPQDGDAG-QTSZRPRMSA-N |
| XLogP | 4.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|