C19H20N2O4S — CID 143236604
6-benzyl-4-(4-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione (PubChem CID 143236604) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 6-benzyl-4-(4-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione.
| Compound Name | 6-benzyl-4-(4-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 143236604 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 6-benzyl-4-(4-methylphenyl)sulfonyl-1,4-diazepane-2,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)NCC(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-14-7-9-17(10-8-14)26(24,25)21-13-18(22)20-12-16(19(21)23)11-15-5-3-2-4-6-15/h2-10,16H,11-13H2,1H3,(H,20,22) |
| InChIKey | FNQAVHVCKKYFGP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |