C24H20F10INO2S — CID 164682406
4-[(4-fluorophenyl)-iodomethylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine (PubChem CID 164682406) has the molecular formula C24H20F10INO2S and a molecular weight of 703.38 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)-iodomethylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine.
| Compound Name | 4-[(4-fluorophenyl)-iodomethylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine |
|---|---|
| PubChem CID | 164682406 |
| Molecular Formula | C24H20F10INO2S |
| Molecular Weight | 703.38 g/mol |
| Exact Mass | 703.01 |
| IUPAC Name | 4-[(4-fluorophenyl)-iodomethylidene]-3-methyl-1-(4-methylphenyl)sulfonyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=C(I)c3ccc(F)cc3)C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C24H20F10INO2S/c1-14-3-9-17(10-4-14)39(37,38)36-11-18(19(35)15-5-7-16(25)8-6-15)20(2,13-36)12-21(26,27)22(28,29)23(30,31)24(32,33)34/h3-10H,11-13H2,1-2H3 |
| InChIKey | CRWUITOIXRJRSC-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.38 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|