C11H10BrIN2O4 — CID 107433911
2-[(2-amino-2-oxoethyl)-(5-bromo-2-iodobenzoyl)amino]acetic acid (PubChem CID 107433911) has the molecular formula C11H10BrIN2O4 and a molecular weight of 441.02 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(5-bromo-2-iodobenzoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(5-bromo-2-iodobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107433911 |
| Molecular Formula | C11H10BrIN2O4 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 439.89 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(5-bromo-2-iodobenzoyl)amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C11H10BrIN2O4/c12-6-1-2-8(13)7(3-6)11(19)15(4-9(14)16)5-10(17)18/h1-3H,4-5H2,(H2,14,16)(H,17,18) |
| InChIKey | DCLUJJLJDFDWIS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|