C11H9I3N2O4 — CID 107434496
2-[(2-amino-2-oxoethyl)-(2,3,5-triiodobenzoyl)amino]acetic acid (PubChem CID 107434496) has the molecular formula C11H9I3N2O4 and a molecular weight of 613.91 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(2,3,5-triiodobenzoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(2,3,5-triiodobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107434496 |
| Molecular Formula | C11H9I3N2O4 |
| Molecular Weight | 613.91 g/mol |
| Exact Mass | 613.77 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(2,3,5-triiodobenzoyl)amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C11H9I3N2O4/c12-5-1-6(10(14)7(13)2-5)11(20)16(3-8(15)17)4-9(18)19/h1-2H,3-4H2,(H2,15,17)(H,18,19) |
| InChIKey | UXBULTOFCXIWDQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.91 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|