C12H12F2N2O4S — CID 107434815
2-[(2-amino-2-oxoethyl)-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid (PubChem CID 107434815) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107434815 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C12H12F2N2O4S/c13-12(14)21-8-4-2-1-3-7(8)11(20)16(5-9(15)17)6-10(18)19/h1-4,12H,5-6H2,(H2,15,17)(H,18,19) |
| InChIKey | PZXXLRIKOAZRHQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |