C14H15F2NO3S — CID 43655584
2-[cyclopropylmethyl-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid (PubChem CID 43655584) has the molecular formula C14H15F2NO3S and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 43655584 |
| Molecular Formula | C14H15F2NO3S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[cyclopropylmethyl-[2-(difluoromethylsulfanyl)benzoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C(=O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C14H15F2NO3S/c15-14(16)21-11-4-2-1-3-10(11)13(20)17(8-12(18)19)7-9-5-6-9/h1-4,9,14H,5-8H2,(H,18,19) |
| InChIKey | QAVZGULTEDPCJK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |