C14H17F2NO2S — CID 103279883
2-(difluoromethylsulfanyl)-N-[(3-hydroxycyclopentyl)methyl]benzamide (PubChem CID 103279883) has the molecular formula C14H17F2NO2S and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[(3-hydroxycyclopentyl)methyl]benzamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[(3-hydroxycyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 103279883 |
| Molecular Formula | C14H17F2NO2S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[(3-hydroxycyclopentyl)methyl]benzamide |
| SMILES | O=C(NCC1CCC(O)C1)c1ccccc1SC(F)F |
| InChI | InChI=1S/C14H17F2NO2S/c15-14(16)20-12-4-2-1-3-11(12)13(19)17-8-9-5-6-10(18)7-9/h1-4,9-10,14,18H,5-8H2,(H,17,19) |
| InChIKey | PAAAEYHJRMJBMR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |