C19H27NO2S — CID 111460429
N-[(3-hydroxycyclohexyl)methyl]-2-(3-methylbut-2-enylsulfanyl)benzamide (PubChem CID 111460429) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-2-(3-methylbut-2-enylsulfanyl)benzamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-2-(3-methylbut-2-enylsulfanyl)benzamide |
|---|---|
| PubChem CID | 111460429 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-2-(3-methylbut-2-enylsulfanyl)benzamide |
| SMILES | CC(C)=CCSc1ccccc1C(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C19H27NO2S/c1-14(2)10-11-23-18-9-4-3-8-17(18)19(22)20-13-15-6-5-7-16(21)12-15/h3-4,8-10,15-16,21H,5-7,11-13H2,1-2H3,(H,20,22) |
| InChIKey | ARDOGJIUKBNUMD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|