C11H12N2O6 — CID 107728235
2-[(2-amino-2-oxoethyl)-(3,4-dihydroxybenzoyl)amino]acetic acid (PubChem CID 107728235) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(3,4-dihydroxybenzoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(3,4-dihydroxybenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107728235 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(3,4-dihydroxybenzoyl)amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H12N2O6/c12-9(16)4-13(5-10(17)18)11(19)6-1-2-7(14)8(15)3-6/h1-3,14-15H,4-5H2,(H2,12,16)(H,17,18) |
| InChIKey | VWXKRSNCHILEAJ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|