C11H11N3O6 — CID 107433891
2-[(2-amino-2-oxoethyl)-(4-nitrobenzoyl)amino]acetic acid (PubChem CID 107433891) has the molecular formula C11H11N3O6 and a molecular weight of 281.22 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(4-nitrobenzoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(4-nitrobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107433891 |
| Molecular Formula | C11H11N3O6 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(4-nitrobenzoyl)amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11N3O6/c12-9(15)5-13(6-10(16)17)11(18)7-1-3-8(4-2-7)14(19)20/h1-4H,5-6H2,(H2,12,15)(H,16,17) |
| InChIKey | YMOOJZYPQRYNPM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|