C17H26N4O9 — CID 18531946
N-(2-amino-2-oxoethyl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide;oxalic acid;hydrate (PubChem CID 18531946) has the molecular formula C17H26N4O9 and a molecular weight of 430.41 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide;oxalic acid;hydrate.
| Compound Name | N-(2-amino-2-oxoethyl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide;oxalic acid;hydrate |
|---|---|
| PubChem CID | 18531946 |
| Molecular Formula | C17H26N4O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-[2-(diethylamino)ethyl]-4-nitrobenzamide;oxalic acid;hydrate |
| SMILES | CCN(CC)CCN(CC(N)=O)C(=O)c1ccc([N+](=O)[O-])cc1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H22N4O4.C2H2O4.H2O/c1-3-17(4-2)9-10-18(11-14(16)20)15(21)12-5-7-13(8-6-12)19(22)23;3-1(4)2(5)6;/h5-8H,3-4,9-11H2,1-2H3,(H2,16,20);(H,3,4)(H,5,6);1H2 |
| InChIKey | LNCIMOHBVLDSQO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 215.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|