C23H36N4O8 — CID 110193982
N-[2-(diethylamino)ethyl]-N-[2-[di(propan-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide;oxalic acid (PubChem CID 110193982) has the molecular formula C23H36N4O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-[2-[di(propan-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide;oxalic acid.
| Compound Name | N-[2-(diethylamino)ethyl]-N-[2-[di(propan-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide;oxalic acid |
|---|---|
| PubChem CID | 110193982 |
| Molecular Formula | C23H36N4O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-[2-[di(propan-2-yl)amino]-2-oxoethyl]-4-nitrobenzamide;oxalic acid |
| SMILES | CCN(CC)CCN(CC(=O)N(C(C)C)C(C)C)C(=O)c1ccc([N+](=O)[O-])cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H34N4O4.C2H2O4/c1-7-22(8-2)13-14-23(15-20(26)24(16(3)4)17(5)6)21(27)18-9-11-19(12-10-18)25(28)29;3-1(4)2(5)6/h9-12,16-17H,7-8,13-15H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | NLUDTEZDWWKWIN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|